About Pulrodemstat
Pulrodemstat (PubChem CID 118483201) has the molecular formula C24H23F2N5O2
and a molecular weight of 451.50 g/mol. Its IUPAC name is 4-[2-(4-aminopiperidin-1-yl)-5-(3-fluoro-4-methoxyphenyl)-1-methyl-6-oxopyrimidin-4-yl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | Pulrodemstat |
| PubChem CID | 118483201 |
| Molecular Formula | C24H23F2N5O2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[2-(4-aminopiperidin-1-yl)-5-(3-fluoro-4-methoxyphenyl)-1-methyl-6-oxopyrimidin-4-yl]-2-fluorobenzonitrile |
| SMILES | CN1C(=O)C(=C(N=C1N2CCC(CC2)N)C3=CC(=C(C=C3)C#N)F)C4=CC(=C(C=C4)OC)F |
| InChI | InChI=1S/C24H23F2N5O2/c1-30-23(32)21(14-5-6-20(33-2)19(26)11-14)22(15-3-4-16(13-27)18(25)12-15)29-24(30)31-9-7-17(28)8-10-31/h3-6,11-12,17H,7-10,28H2,1-2H3 |
| InChIKey | NBAIXBAUHIQQGF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | 860 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Pulrodemstat with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pulrodemstat?
The IUPAC name of Pulrodemstat (CID 118483201) is 4-[2-(4-aminopiperidin-1-yl)-5-(3-fluoro-4-methoxyphenyl)-1-methyl-6-oxopyrimidin-4-yl]-2-fluorobenzonitrile.
What is the SMILES notation for Pulrodemstat?
The canonical SMILES for Pulrodemstat is CN1C(=O)C(=C(N=C1N2CCC(CC2)N)C3=CC(=C(C=C3)C#N)F)C4=CC(=C(C=C4)OC)F.
What is the InChIKey of Pulrodemstat?
The InChIKey is NBAIXBAUHIQQGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2N5O2/c1-30-23(32)21(14-5-6-20(33-2)19(26)11-14)22(15-3-4-16(13-27)18(25)12-15)29-24(30)31-9-7-17(28)8-10-31/h3-6,11-12,17H,7-10,28H2,1-2H3.
What are the key properties of Pulrodemstat?
Pulrodemstat has a molecular weight of 451.50 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Pulrodemstat is sourced from PubChem (CID 118483201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).