C24H24FN5O2 — CID 118483087
US10023543, Example 53 (PubChem CID 118483087) has the molecular formula C24H24FN5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-fluoro-4-[5-(4-methoxyphenyl)-1-methyl-6-oxo-2-(piperidin-4-ylamino)pyrimidin-4-yl]benzonitrile.
| Compound Name | US10023543, Example 53 |
|---|---|
| PubChem CID | 118483087 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-fluoro-4-[5-(4-methoxyphenyl)-1-methyl-6-oxo-2-(piperidin-4-ylamino)pyrimidin-4-yl]benzonitrile |
| SMILES | CN1C(=O)C(=C(N=C1NC2CCNCC2)C3=CC(=C(C=C3)C#N)F)C4=CC=C(C=C4)OC |
| InChI | InChI=1S/C24H24FN5O2/c1-30-23(31)21(15-5-7-19(32-2)8-6-15)22(16-3-4-17(14-26)20(25)13-16)29-24(30)28-18-9-11-27-12-10-18/h3-8,13,18,27H,9-12H2,1-2H3,(H,28,29) |
| InChIKey | SLNMGKBACWYEPQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | 804 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |