About 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine
4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine (PubChem CID 118483533) has the molecular formula C12H12F5N
and a molecular weight of 265.22 g/mol. Its IUPAC name is 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine.
Molecular Properties
| Compound Name | 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine |
| PubChem CID | 118483533 |
| Molecular Formula | C12H12F5N |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine |
| SMILES | Fc1ccc(C2CCNCC2)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H12F5N/c13-9-2-1-8(7-3-5-18-6-4-7)10(11(9)14)12(15,16)17/h1-2,7,18H,3-6H2 |
| InChIKey | CFWQHBVZNMPCOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine?
The IUPAC name of 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine (CID 118483533) is 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine.
What is the SMILES notation for 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine?
The canonical SMILES for 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine is Fc1ccc(C2CCNCC2)c(C(F)(F)F)c1F.
What is the InChIKey of 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine?
The InChIKey is CFWQHBVZNMPCOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F5N/c13-9-2-1-8(7-3-5-18-6-4-7)10(11(9)14)12(15,16)17/h1-2,7,18H,3-6H2.
What are the key properties of 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine?
4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine has a molecular weight of 265.22 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine is sourced from PubChem (CID 118483533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).