C12H12F5N — CID 118483533
4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine (PubChem CID 118483533) has the molecular formula C12H12F5N and a molecular weight of 265.22 g/mol. Its IUPAC name is 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 118483533 |
| Molecular Formula | C12H12F5N |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine |
| SMILES | Fc1ccc(C2CCNCC2)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H12F5N/c13-9-2-1-8(7-3-5-18-6-4-7)10(11(9)14)12(15,16)17/h1-2,7,18H,3-6H2 |
| InChIKey | CFWQHBVZNMPCOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |