(NE)-N-ethylidenehydroxylamine;sulfuric acid

C2H7NO5S — CID 118485193

IUPAC(NE)-N-ethylidenehydroxylamine;sulfuric acid
SMILESC/C=N/O.O=S(=O)(O)O
InChIInChI=1S/C2H5NO.H2O4S/c1-2-3-4;1-5(2,3)4/h2,4H,1H3;(H2,1,2,3,4)/b3-2+;
InChIKeyIUXCFYWZKCGYBV-SQQVDAMQSA-N
MW157.15 g/mol
LogP-0.19
Rot. Bonds

About (NE)-N-ethylidenehydroxylamine;sulfuric acid

(NE)-N-ethylidenehydroxylamine;sulfuric acid (PubChem CID 118485193) has the molecular formula C2H7NO5S and a molecular weight of 157.15 g/mol. Its IUPAC name is (NE)-N-ethylidenehydroxylamine;sulfuric acid.

Molecular Properties

Compound Name(NE)-N-ethylidenehydroxylamine;sulfuric acid
PubChem CID118485193
Molecular FormulaC2H7NO5S
Molecular Weight157.15 g/mol
Exact Mass157.00
IUPAC Name(NE)-N-ethylidenehydroxylamine;sulfuric acid
SMILESC/C=N/O.O=S(=O)(O)O
InChIInChI=1S/C2H5NO.H2O4S/c1-2-3-4;1-5(2,3)4/h2,4H,1H3;(H2,1,2,3,4)/b3-2+;
InChIKeyIUXCFYWZKCGYBV-SQQVDAMQSA-N
XLogP-0.19
TPSA107.19 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.15
LogP ≤ 5-0.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (NE)-N-ethylidenehydroxylamine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (NE)-N-ethylidenehydroxylamine;sulfuric acid?
The IUPAC name of (NE)-N-ethylidenehydroxylamine;sulfuric acid (CID 118485193) is (NE)-N-ethylidenehydroxylamine;sulfuric acid.
What is the SMILES notation for (NE)-N-ethylidenehydroxylamine;sulfuric acid?
The canonical SMILES for (NE)-N-ethylidenehydroxylamine;sulfuric acid is C/C=N/O.O=S(=O)(O)O.
What is the InChIKey of (NE)-N-ethylidenehydroxylamine;sulfuric acid?
The InChIKey is IUXCFYWZKCGYBV-SQQVDAMQSA-N. The full InChI is InChI=1S/C2H5NO.H2O4S/c1-2-3-4;1-5(2,3)4/h2,4H,1H3;(H2,1,2,3,4)/b3-2+;.
What are the key properties of (NE)-N-ethylidenehydroxylamine;sulfuric acid?
(NE)-N-ethylidenehydroxylamine;sulfuric acid has a molecular weight of 157.15 g/mol, XLogP of -0.19, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-ethylidenehydroxylamine;sulfuric acid is sourced from PubChem (CID 118485193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).