C24H37N3O3 — CID 118486457
N-(5-ethyl-7-methyloctan-4-yl)-1-(2-hydroxyethyl)-5-phenylmethoxypyrazole-4-carboxamide (PubChem CID 118486457) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-(5-ethyl-7-methyloctan-4-yl)-1-(2-hydroxyethyl)-5-phenylmethoxypyrazole-4-carboxamide.
| Compound Name | N-(5-ethyl-7-methyloctan-4-yl)-1-(2-hydroxyethyl)-5-phenylmethoxypyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118486457 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | N-(5-ethyl-7-methyloctan-4-yl)-1-(2-hydroxyethyl)-5-phenylmethoxypyrazole-4-carboxamide |
| SMILES | CCCC(NC(=O)c1cnn(CCO)c1OCc1ccccc1)C(CC)CC(C)C |
| InChI | InChI=1S/C24H37N3O3/c1-5-10-22(20(6-2)15-18(3)4)26-23(29)21-16-25-27(13-14-28)24(21)30-17-19-11-8-7-9-12-19/h7-9,11-12,16,18,20,22,28H,5-6,10,13-15,17H2,1-4H3,(H,26,29) |
| InChIKey | KACZKVDAURUVAW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |