C24H35N3O5S — CID 89245805
2-[4-[[2-(2-ethylbutyl)cyclobutyl]carbamoyl]-5-phenylmethoxypyrazol-1-yl]ethyl methanesulfonate (PubChem CID 89245805) has the molecular formula C24H35N3O5S and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-[4-[[2-(2-ethylbutyl)cyclobutyl]carbamoyl]-5-phenylmethoxypyrazol-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[4-[[2-(2-ethylbutyl)cyclobutyl]carbamoyl]-5-phenylmethoxypyrazol-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 89245805 |
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-[4-[[2-(2-ethylbutyl)cyclobutyl]carbamoyl]-5-phenylmethoxypyrazol-1-yl]ethyl methanesulfonate |
| SMILES | CCC(CC)CC1CCC1NC(=O)c1cnn(CCOS(C)(=O)=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H35N3O5S/c1-4-18(5-2)15-20-11-12-22(20)26-23(28)21-16-25-27(13-14-32-33(3,29)30)24(21)31-17-19-9-7-6-8-10-19/h6-10,16,18,20,22H,4-5,11-15,17H2,1-3H3,(H,26,28) |
| InChIKey | GTWIYBIOJMGMOZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|