C26H36N2O4 — CID 118486756
amino 3-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2S)-2-[(4-methylphenyl)methyl]pyrrolidin-1-yl]propoxy]ethyl]phenyl]propanoate (PubChem CID 118486756) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is amino 3-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2S)-2-[(4-methylphenyl)methyl]pyrrolidin-1-yl]propoxy]ethyl]phenyl]propanoate.
| Compound Name | amino 3-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2S)-2-[(4-methylphenyl)methyl]pyrrolidin-1-yl]propoxy]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 118486756 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | amino 3-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2S)-2-[(4-methylphenyl)methyl]pyrrolidin-1-yl]propoxy]ethyl]phenyl]propanoate |
| SMILES | Cc1ccc(C[C@@H]2CCCN2C[C@@H](O)CO[C@H](C)c2ccccc2CCC(=O)ON)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-19-9-11-21(12-10-19)16-23-7-5-15-28(23)17-24(29)18-31-20(2)25-8-4-3-6-22(25)13-14-26(30)32-27/h3-4,6,8-12,20,23-24,29H,5,7,13-18,27H2,1-2H3/t20-,23+,24-/m1/s1 |
| InChIKey | AHYDHBCKCUBZPA-FGCOXFRFSA-N |
| XLogP | 3.49 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|