C16H19N3O3S — CID 118488084
5-[[(3aS,6aS)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]sulfonyl]-4-methoxyisoquinoline (PubChem CID 118488084) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-[[(3aS,6aS)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]sulfonyl]-4-methoxyisoquinoline.
| Compound Name | 5-[[(3aS,6aS)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]sulfonyl]-4-methoxyisoquinoline |
|---|---|
| PubChem CID | 118488084 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-[[(3aS,6aS)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl]sulfonyl]-4-methoxyisoquinoline |
| SMILES | COc1cncc2cccc(S(=O)(=O)N3CC[C@@H]4NCC[C@@H]43)c12 |
| InChI | InChI=1S/C16H19N3O3S/c1-22-14-10-17-9-11-3-2-4-15(16(11)14)23(20,21)19-8-6-12-13(19)5-7-18-12/h2-4,9-10,12-13,18H,5-8H2,1H3/t12-,13-/m0/s1 |
| InChIKey | AZJLOMOIDQMFSN-STQMWFEESA-N |
| XLogP | 1.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |