About 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine
2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine (PubChem CID 118489358) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine.
Analyze 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine (CID 118489358) is 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine is CC(C)C1=NC2N=CC=CC2N1.
What is the InChIKey of 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine?
The InChIKey is JYTUDYGBMRCVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6(2)8-11-7-4-3-5-10-9(7)12-8/h3-7,9H,1-2H3,(H,11,12).
What are the key properties of 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine?
2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine has a molecular weight of 163.22 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 118489358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).