C17H15FN2O3 — CID 118489513
3-[4-[[3-(fluoromethoxy)phenyl]methoxy]phenyl]-1,2-oxazol-4-amine (PubChem CID 118489513) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-[4-[[3-(fluoromethoxy)phenyl]methoxy]phenyl]-1,2-oxazol-4-amine.
| Compound Name | 3-[4-[[3-(fluoromethoxy)phenyl]methoxy]phenyl]-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 118489513 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[4-[[3-(fluoromethoxy)phenyl]methoxy]phenyl]-1,2-oxazol-4-amine |
| SMILES | Nc1conc1-c1ccc(OCc2cccc(OCF)c2)cc1 |
| InChI | InChI=1S/C17H15FN2O3/c18-11-22-15-3-1-2-12(8-15)9-21-14-6-4-13(5-7-14)17-16(19)10-23-20-17/h1-8,10H,9,11,19H2 |
| InChIKey | UNOMMUIECGQUOL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |