C24H31NO2 — CID 118493255
(4R)-4-[(2-methyl-3-oxo-4-phenylbutyl)amino]-1-phenylheptan-2-one (PubChem CID 118493255) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (4R)-4-[(2-methyl-3-oxo-4-phenylbutyl)amino]-1-phenylheptan-2-one.
| Compound Name | (4R)-4-[(2-methyl-3-oxo-4-phenylbutyl)amino]-1-phenylheptan-2-one |
|---|---|
| PubChem CID | 118493255 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (4R)-4-[(2-methyl-3-oxo-4-phenylbutyl)amino]-1-phenylheptan-2-one |
| SMILES | CCC[C@H](CC(=O)Cc1ccccc1)NCC(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-3-10-22(17-23(26)15-20-11-6-4-7-12-20)25-18-19(2)24(27)16-21-13-8-5-9-14-21/h4-9,11-14,19,22,25H,3,10,15-18H2,1-2H3/t19?,22-/m1/s1 |
| InChIKey | IYMUPADDRZYEOI-AVKWCDSFSA-N |
| XLogP | 4.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |