C20H33NO — CID 143057501
3-methyl-5-(1-phenylhexan-3-ylamino)heptan-4-one (PubChem CID 143057501) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-methyl-5-(1-phenylhexan-3-ylamino)heptan-4-one.
| Compound Name | 3-methyl-5-(1-phenylhexan-3-ylamino)heptan-4-one |
|---|---|
| PubChem CID | 143057501 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-methyl-5-(1-phenylhexan-3-ylamino)heptan-4-one |
| SMILES | CCCC(CCc1ccccc1)NC(CC)C(=O)C(C)CC |
| InChI | InChI=1S/C20H33NO/c1-5-11-18(15-14-17-12-9-8-10-13-17)21-19(7-3)20(22)16(4)6-2/h8-10,12-13,16,18-19,21H,5-7,11,14-15H2,1-4H3 |
| InChIKey | SUROGEQVCYCNNX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |