C17H25F2NO — CID 167903936
4,4-difluoro-2-methyl-N-(1-phenylhexan-3-yl)butanamide (PubChem CID 167903936) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 4,4-difluoro-2-methyl-N-(1-phenylhexan-3-yl)butanamide.
| Compound Name | 4,4-difluoro-2-methyl-N-(1-phenylhexan-3-yl)butanamide |
|---|---|
| PubChem CID | 167903936 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4,4-difluoro-2-methyl-N-(1-phenylhexan-3-yl)butanamide |
| SMILES | CCCC(CCc1ccccc1)NC(=O)C(C)CC(F)F |
| InChI | InChI=1S/C17H25F2NO/c1-3-7-15(11-10-14-8-5-4-6-9-14)20-17(21)13(2)12-16(18)19/h4-6,8-9,13,15-16H,3,7,10-12H2,1-2H3,(H,20,21) |
| InChIKey | PTGPFBSEOUCLFX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |