C14H27NO2 — CID 118494464
N-(2,3-dimethylbutyl)-3-methyl-5-oxoheptanamide (PubChem CID 118494464) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-3-methyl-5-oxoheptanamide.
| Compound Name | N-(2,3-dimethylbutyl)-3-methyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 118494464 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-(2,3-dimethylbutyl)-3-methyl-5-oxoheptanamide |
| SMILES | CCC(=O)CC(C)CC(=O)NCC(C)C(C)C |
| InChI | InChI=1S/C14H27NO2/c1-6-13(16)7-11(4)8-14(17)15-9-12(5)10(2)3/h10-12H,6-9H2,1-5H3,(H,15,17) |
| InChIKey | PVIPJFHFOKUHRK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |