C12H18N2O3 — CID 118494579
tert-butyl N-[(3S,6Z)-6-(cyanomethylidene)oxan-3-yl]carbamate (PubChem CID 118494579) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is tert-butyl N-[(3S,6Z)-6-(cyanomethylidene)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6Z)-6-(cyanomethylidene)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 118494579 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | tert-butyl N-[(3S,6Z)-6-(cyanomethylidene)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC/C(=C/C#N)OC1 |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,3)17-11(15)14-9-4-5-10(6-7-13)16-8-9/h6,9H,4-5,8H2,1-3H3,(H,14,15)/b10-6-/t9-/m0/s1 |
| InChIKey | RJCUMWZBUQLWBM-LKJZUNMESA-N |
| XLogP | 2.10 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|