C11H11FN2O3 — CID 118498347
4-(7-fluoro-1-oxo-2H-pyrrolo[1,2-a]pyrazin-3-yl)butanoic acid (PubChem CID 118498347) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-(7-fluoro-1-oxo-2H-pyrrolo[1,2-a]pyrazin-3-yl)butanoic acid.
| Compound Name | 4-(7-fluoro-1-oxo-2H-pyrrolo[1,2-a]pyrazin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 118498347 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-(7-fluoro-1-oxo-2H-pyrrolo[1,2-a]pyrazin-3-yl)butanoic acid |
| SMILES | O=C(O)CCCc1cn2cc(F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H11FN2O3/c12-7-4-9-11(17)13-8(6-14(9)5-7)2-1-3-10(15)16/h4-6H,1-3H2,(H,13,17)(H,15,16) |
| InChIKey | YNVFCGISEJUMJC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |