C28H33N5O3 — CID 118498749
3-methyl-4-[(3S)-oxolan-3-yl]-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-1H-imidazo[4,5-c]quinolin-2-one (PubChem CID 118498749) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-methyl-4-[(3S)-oxolan-3-yl]-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-1H-imidazo[4,5-c]quinolin-2-one.
| Compound Name | 3-methyl-4-[(3S)-oxolan-3-yl]-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-1H-imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 118498749 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 3-methyl-4-[(3S)-oxolan-3-yl]-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-1H-imidazo[4,5-c]quinolin-2-one |
| SMILES | Cn1c(=O)[nH]c2c3cc(-c4ccc(OCCCN5CCCCC5)nc4)ccc3nc([C@@H]3CCOC3)c21 |
| InChI | InChI=1S/C28H33N5O3/c1-32-27-25(21-10-15-35-18-21)30-23-8-6-19(16-22(23)26(27)31-28(32)34)20-7-9-24(29-17-20)36-14-5-13-33-11-3-2-4-12-33/h6-9,16-17,21H,2-5,10-15,18H2,1H3,(H,31,34)/t21-/m1/s1 |
| InChIKey | LVLDYWZQLBCTBE-OAQYLSRUSA-N |
| XLogP | 4.24 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|