C30H34F3N5O4 — CID 118523405
1-cyclobutyl-3-methyl-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 118523405) has the molecular formula C30H34F3N5O4 and a molecular weight of 585.63 g/mol. Its IUPAC name is 1-cyclobutyl-3-methyl-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-cyclobutyl-3-methyl-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118523405 |
| Molecular Formula | C30H34F3N5O4 |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 1-cyclobutyl-3-methyl-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cn1c(=O)n(C2CCC2)c2c3cc(-c4ccc(OCCCN5CCCCC5)nc4)ccc3ncc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H33N5O2.C2HF3O2/c1-31-25-19-29-24-11-9-20(17-23(24)27(25)33(28(31)34)22-7-5-8-22)21-10-12-26(30-18-21)35-16-6-15-32-13-3-2-4-14-32;3-2(4,5)1(6)7/h9-12,17-19,22H,2-8,13-16H2,1H3;(H,6,7) |
| InChIKey | WZRCFXLERDSRHK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|