C30H37FN4O3 — CID 134377641
8-(2-fluoro-6-nonoxy-3-pyridinyl)-3-methyl-1-(oxan-3-yl)imidazo[4,5-c]quinolin-2-one (PubChem CID 134377641) has the molecular formula C30H37FN4O3 and a molecular weight of 520.65 g/mol. Its IUPAC name is 8-(2-fluoro-6-nonoxy-3-pyridinyl)-3-methyl-1-(oxan-3-yl)imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-(2-fluoro-6-nonoxy-3-pyridinyl)-3-methyl-1-(oxan-3-yl)imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 134377641 |
| Molecular Formula | C30H37FN4O3 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 8-(2-fluoro-6-nonoxy-3-pyridinyl)-3-methyl-1-(oxan-3-yl)imidazo[4,5-c]quinolin-2-one |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc3ncc4c(c3c2)n(C2CCCOC2)c(=O)n4C)c(F)n1 |
| InChI | InChI=1S/C30H37FN4O3/c1-3-4-5-6-7-8-9-17-38-27-15-13-23(29(31)33-27)21-12-14-25-24(18-21)28-26(19-32-25)34(2)30(36)35(28)22-11-10-16-37-20-22/h12-15,18-19,22H,3-11,16-17,20H2,1-2H3 |
| InChIKey | GJZZQJGEMOUMHE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|