C24H26FN5O3 — CID 163706065
8-(6-butoxy-3-pyridinyl)-7-fluoro-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one (PubChem CID 163706065) has the molecular formula C24H26FN5O3 and a molecular weight of 451.50 g/mol. Its IUPAC name is 8-(6-butoxy-3-pyridinyl)-7-fluoro-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one.
| Compound Name | 8-(6-butoxy-3-pyridinyl)-7-fluoro-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
|---|---|
| PubChem CID | 163706065 |
| Molecular Formula | C24H26FN5O3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 8-(6-butoxy-3-pyridinyl)-7-fluoro-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
| SMILES | CCCCOc1ccc(-c2cc3c(cc2F)nnc2c3n(C3CCOCC3)c(=O)n2C)cn1 |
| InChI | InChI=1S/C24H26FN5O3/c1-3-4-9-33-21-6-5-15(14-26-21)17-12-18-20(13-19(17)25)27-28-23-22(18)30(24(31)29(23)2)16-7-10-32-11-8-16/h5-6,12-14,16H,3-4,7-11H2,1-2H3 |
| InChIKey | AMMTVEHBKQANLM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|