C20H18FN5O2 — CID 138490581
8-(6-fluoro-3-pyridinyl)-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one (PubChem CID 138490581) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 8-(6-fluoro-3-pyridinyl)-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one.
| Compound Name | 8-(6-fluoro-3-pyridinyl)-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
|---|---|
| PubChem CID | 138490581 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 8-(6-fluoro-3-pyridinyl)-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
| SMILES | Cn1c(=O)n(C2CCOCC2)c2c3cc(-c4ccc(F)nc4)ccc3nnc21 |
| InChI | InChI=1S/C20H18FN5O2/c1-25-19-18(26(20(25)27)14-6-8-28-9-7-14)15-10-12(2-4-16(15)23-24-19)13-3-5-17(21)22-11-13/h2-5,10-11,14H,6-9H2,1H3 |
| InChIKey | XADRMBUXZOMFRQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|