About 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one
8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one (PubChem CID 138490734) has the molecular formula C17H19ClN4O2
and a molecular weight of 346.82 g/mol. Its IUPAC name is 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one.
Molecular Properties
| Compound Name | 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one |
| PubChem CID | 138490734 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one |
| SMILES | Cn1c(=O)n([C@@H]2CCOCC2(C)C)c2c3cc(Cl)ccc3nnc21 |
| InChI | InChI=1S/C17H19ClN4O2/c1-17(2)9-24-7-6-13(17)22-14-11-8-10(18)4-5-12(11)19-20-15(14)21(3)16(22)23/h4-5,8,13H,6-7,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | NFBDQTLIWADCGY-CYBMUJFWSA-N |
| XLogP | 2.92 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one?
The IUPAC name of 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one (CID 138490734) is 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one.
What is the SMILES notation for 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one?
The canonical SMILES for 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one is Cn1c(=O)n([C@@H]2CCOCC2(C)C)c2c3cc(Cl)ccc3nnc21.
What is the InChIKey of 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one?
The InChIKey is NFBDQTLIWADCGY-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H19ClN4O2/c1-17(2)9-24-7-6-13(17)22-14-11-8-10(18)4-5-12(11)19-20-15(14)21(3)16(22)23/h4-5,8,13H,6-7,9H2,1-3H3/t13-/m1/s1.
What are the key properties of 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one?
8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one has a molecular weight of 346.82 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-[(4R)-3,3-dimethyloxan-4-yl]-3-methylimidazo[4,5-c]cinnolin-2-one is sourced from PubChem (CID 138490734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).