C25H30N6O3 — CID 175844798
6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one (PubChem CID 175844798) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one.
| Compound Name | 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
|---|---|
| PubChem CID | 175844798 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-(oxan-4-yl)imidazo[4,5-c]cinnolin-2-one |
| SMILES | CN(C)CCCOc1ccc(-c2cccc3c2nnc2c3n(C3CCOCC3)c(=O)n2C)cn1 |
| InChI | InChI=1S/C25H30N6O3/c1-29(2)12-5-13-34-21-9-8-17(16-26-21)19-6-4-7-20-22(19)27-28-24-23(20)31(25(32)30(24)3)18-10-14-33-15-11-18/h4,6-9,16,18H,5,10-15H2,1-3H3 |
| InChIKey | ZHQKDYLASFQDTE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|