C25H31N5O3 — CID 134377485
8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-[(3R)-oxolan-3-yl]-2H-imidazo[4,5-c]quinolin-2-ol (PubChem CID 134377485) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-[(3R)-oxolan-3-yl]-2H-imidazo[4,5-c]quinolin-2-ol.
| Compound Name | 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-[(3R)-oxolan-3-yl]-2H-imidazo[4,5-c]quinolin-2-ol |
|---|---|
| PubChem CID | 134377485 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-[(3R)-oxolan-3-yl]-2H-imidazo[4,5-c]quinolin-2-ol |
| SMILES | CN(C)CCCOc1ccc(-c2ccc3ncc4c(c3c2)N([C@@H]2CCOC2)C(O)N4C)cn1 |
| InChI | InChI=1S/C25H31N5O3/c1-28(2)10-4-11-33-23-8-6-18(14-27-23)17-5-7-21-20(13-17)24-22(15-26-21)29(3)25(31)30(24)19-9-12-32-16-19/h5-8,13-15,19,25,31H,4,9-12,16H2,1-3H3/t19-,25?/m1/s1 |
| InChIKey | HWDDVUJCALEVAB-OEPVSBQMSA-N |
| XLogP | 2.95 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|