C30H42N6O3 — CID 139310623
4-[tert-butyl-[(1S)-1-(oxan-4-yl)ethyl]amino]-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]cinnoline-3-carboxamide (PubChem CID 139310623) has the molecular formula C30H42N6O3 and a molecular weight of 534.71 g/mol. Its IUPAC name is 4-[tert-butyl-[(1S)-1-(oxan-4-yl)ethyl]amino]-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]cinnoline-3-carboxamide.
| Compound Name | 4-[tert-butyl-[(1S)-1-(oxan-4-yl)ethyl]amino]-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 139310623 |
| Molecular Formula | C30H42N6O3 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 4-[tert-butyl-[(1S)-1-(oxan-4-yl)ethyl]amino]-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]cinnoline-3-carboxamide |
| SMILES | C[C@@H](C1CCOCC1)N(c1c(C(N)=O)nnc2ccc(-c3ccc(OCCCN(C)C)nc3)cc12)C(C)(C)C |
| InChI | InChI=1S/C30H42N6O3/c1-20(21-12-16-38-17-13-21)36(30(2,3)4)28-24-18-22(8-10-25(24)33-34-27(28)29(31)37)23-9-11-26(32-19-23)39-15-7-14-35(5)6/h8-11,18-21H,7,12-17H2,1-6H3,(H2,31,37)/t20-/m0/s1 |
| InChIKey | GEBYGDXKQGLCAF-FQEVSTJZSA-N |
| XLogP | 4.54 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|