C27H36N6O3 — CID 139314889
6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-[methyl-[(1S)-1-(oxan-4-yl)ethyl]amino]cinnoline-3-carboxamide (PubChem CID 139314889) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-[methyl-[(1S)-1-(oxan-4-yl)ethyl]amino]cinnoline-3-carboxamide.
| Compound Name | 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-[methyl-[(1S)-1-(oxan-4-yl)ethyl]amino]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 139314889 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-[methyl-[(1S)-1-(oxan-4-yl)ethyl]amino]cinnoline-3-carboxamide |
| SMILES | C[C@@H](C1CCOCC1)N(C)c1c(C(N)=O)nnc2ccc(-c3ccc(OCCCN(C)C)nc3)cc12 |
| InChI | InChI=1S/C27H36N6O3/c1-18(19-10-14-35-15-11-19)33(4)26-22-16-20(6-8-23(22)30-31-25(26)27(28)34)21-7-9-24(29-17-21)36-13-5-12-32(2)3/h6-9,16-19H,5,10-15H2,1-4H3,(H2,28,34)/t18-/m0/s1 |
| InChIKey | SMUUVUKQBVBQMW-SFHVURJKSA-N |
| XLogP | 3.37 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|