C28H34N4O3 — CID 123286209
7-methyl-2-[6-[3-(methylamino)propoxy]-3-pyridinyl]-10-(oxan-4-yl)-10,11-dihydro-9H-azepino[2,3-c]quinolin-8-one (PubChem CID 123286209) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 7-methyl-2-[6-[3-(methylamino)propoxy]-3-pyridinyl]-10-(oxan-4-yl)-10,11-dihydro-9H-azepino[2,3-c]quinolin-8-one.
| Compound Name | 7-methyl-2-[6-[3-(methylamino)propoxy]-3-pyridinyl]-10-(oxan-4-yl)-10,11-dihydro-9H-azepino[2,3-c]quinolin-8-one |
|---|---|
| PubChem CID | 123286209 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 7-methyl-2-[6-[3-(methylamino)propoxy]-3-pyridinyl]-10-(oxan-4-yl)-10,11-dihydro-9H-azepino[2,3-c]quinolin-8-one |
| SMILES | CNCCCOc1ccc(-c2ccc3ncc4c(c3c2)CC(C2CCOCC2)CC(=O)N4C)cn1 |
| InChI | InChI=1S/C28H34N4O3/c1-29-10-3-11-35-27-7-5-21(17-31-27)20-4-6-25-23(14-20)24-15-22(19-8-12-34-13-9-19)16-28(33)32(2)26(24)18-30-25/h4-7,14,17-19,22,29H,3,8-13,15-16H2,1-2H3 |
| InChIKey | NYPQSYPJPVDJTR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|