C25H31N5O2 — CID 177173317
N,N-dimethyl-2-[6-[2-(methylamino)ethoxy]-3-pyridinyl]-4-(2-oxa-7-azaspiro[3.4]octan-7-yl)quinolin-7-amine (PubChem CID 177173317) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N,N-dimethyl-2-[6-[2-(methylamino)ethoxy]-3-pyridinyl]-4-(2-oxa-7-azaspiro[3.4]octan-7-yl)quinolin-7-amine.
| Compound Name | N,N-dimethyl-2-[6-[2-(methylamino)ethoxy]-3-pyridinyl]-4-(2-oxa-7-azaspiro[3.4]octan-7-yl)quinolin-7-amine |
|---|---|
| PubChem CID | 177173317 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N,N-dimethyl-2-[6-[2-(methylamino)ethoxy]-3-pyridinyl]-4-(2-oxa-7-azaspiro[3.4]octan-7-yl)quinolin-7-amine |
| SMILES | CNCCOc1ccc(-c2cc(N3CCC4(COC4)C3)c3ccc(N(C)C)cc3n2)cn1 |
| InChI | InChI=1S/C25H31N5O2/c1-26-9-11-32-24-7-4-18(14-27-24)21-13-23(30-10-8-25(15-30)16-31-17-25)20-6-5-19(29(2)3)12-22(20)28-21/h4-7,12-14,26H,8-11,15-17H2,1-3H3 |
| InChIKey | HTGAACUPOOKDRC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|