C20H22ClN5 — CID 177172690
4-chloro-N,N-dimethyl-2-(6-piperazin-1-yl-3-pyridinyl)quinolin-7-amine (PubChem CID 177172690) has the molecular formula C20H22ClN5 and a molecular weight of 367.88 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-(6-piperazin-1-yl-3-pyridinyl)quinolin-7-amine.
| Compound Name | 4-chloro-N,N-dimethyl-2-(6-piperazin-1-yl-3-pyridinyl)quinolin-7-amine |
|---|---|
| PubChem CID | 177172690 |
| Molecular Formula | C20H22ClN5 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-(6-piperazin-1-yl-3-pyridinyl)quinolin-7-amine |
| SMILES | CN(C)c1ccc2c(Cl)cc(-c3ccc(N4CCNCC4)nc3)nc2c1 |
| InChI | InChI=1S/C20H22ClN5/c1-25(2)15-4-5-16-17(21)12-18(24-19(16)11-15)14-3-6-20(23-13-14)26-9-7-22-8-10-26/h3-6,11-13,22H,7-10H2,1-2H3 |
| InChIKey | NGFVTTZMSNJPRU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |