C18H23N5 — CID 141335696
4-cyclopropyl-6-[6-(1,4-diazepan-1-yl)-3-pyridinyl]pyridin-2-amine (PubChem CID 141335696) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-cyclopropyl-6-[6-(1,4-diazepan-1-yl)-3-pyridinyl]pyridin-2-amine.
| Compound Name | 4-cyclopropyl-6-[6-(1,4-diazepan-1-yl)-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 141335696 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-cyclopropyl-6-[6-(1,4-diazepan-1-yl)-3-pyridinyl]pyridin-2-amine |
| SMILES | Nc1cc(C2CC2)cc(-c2ccc(N3CCCNCC3)nc2)n1 |
| InChI | InChI=1S/C18H23N5/c19-17-11-15(13-2-3-13)10-16(22-17)14-4-5-18(21-12-14)23-8-1-6-20-7-9-23/h4-5,10-13,20H,1-3,6-9H2,(H2,19,22) |
| InChIKey | CCVHOJNNQQCHMS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |