C17H24ClN3 — CID 23321153
5,8-diethyl-3-piperazin-1-ylisoquinoline;hydrochloride (PubChem CID 23321153) has the molecular formula C17H24ClN3 and a molecular weight of 305.85 g/mol. Its IUPAC name is 5,8-diethyl-3-piperazin-1-ylisoquinoline;hydrochloride.
| Compound Name | 5,8-diethyl-3-piperazin-1-ylisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 23321153 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 5,8-diethyl-3-piperazin-1-ylisoquinoline;hydrochloride |
| SMILES | CCc1ccc(CC)c2cc(N3CCNCC3)ncc12.Cl |
| InChI | InChI=1S/C17H23N3.ClH/c1-3-13-5-6-14(4-2)16-12-19-17(11-15(13)16)20-9-7-18-8-10-20;/h5-6,11-12,18H,3-4,7-10H2,1-2H3;1H |
| InChIKey | AGGOKCGCJZJTDQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |