C22H37N7 — CID 171069989
ethane;4-piperazin-1-yl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine;propane (PubChem CID 171069989) has the molecular formula C22H37N7 and a molecular weight of 399.59 g/mol. Its IUPAC name is ethane;4-piperazin-1-yl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine;propane.
| Compound Name | ethane;4-piperazin-1-yl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine;propane |
|---|---|
| PubChem CID | 171069989 |
| Molecular Formula | C22H37N7 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | ethane;4-piperazin-1-yl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidine;propane |
| SMILES | CC.CCC.c1ccc(N2CCN(c3cc(N4CCNCC4)ncn3)CC2)nc1 |
| InChI | InChI=1S/C17H23N7.C3H8.C2H6/c1-2-4-19-15(3-1)23-9-11-24(12-10-23)17-13-16(20-14-21-17)22-7-5-18-6-8-22;1-3-2;1-2/h1-4,13-14,18H,5-12H2;3H2,1-2H3;1-2H3 |
| InChIKey | ODSGKRVSPTZHFL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |