C30H35N7 — CID 159041794
1-[(5-phenyl-3-pyridinyl)methyl]-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine (PubChem CID 159041794) has the molecular formula C30H35N7 and a molecular weight of 493.66 g/mol. Its IUPAC name is 1-[(5-phenyl-3-pyridinyl)methyl]-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine.
| Compound Name | 1-[(5-phenyl-3-pyridinyl)methyl]-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 159041794 |
| Molecular Formula | C30H35N7 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 1-[(5-phenyl-3-pyridinyl)methyl]-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine |
| SMILES | c1ccc(-c2cncc(CN3CCN(c4ccccn4)CC3)c2)cc1.c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C21H22N4.C9H13N3/c1-2-6-19(7-3-1)20-14-18(15-22-16-20)17-24-10-12-25(13-11-24)21-8-4-5-9-23-21;1-2-4-11-9(3-1)12-7-5-10-6-8-12/h1-9,14-16H,10-13,17H2;1-4,10H,5-8H2 |
| InChIKey | JWDOBPNWVCLUEL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |