C19H23N3 — CID 165351505
1-(2,3-dihydro-1H-inden-5-ylmethyl)-4-pyridin-2-ylpiperazine (PubChem CID 165351505) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylmethyl)-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 165351505 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-4-pyridin-2-ylpiperazine |
| SMILES | c1ccc(N2CCN(Cc3ccc4c(c3)CCC4)CC2)nc1 |
| InChI | InChI=1S/C19H23N3/c1-2-9-20-19(6-1)22-12-10-21(11-13-22)15-16-7-8-17-4-3-5-18(17)14-16/h1-2,6-9,14H,3-5,10-13,15H2 |
| InChIKey | NSPGTTPHLHJSKO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |