C24H23N3O — CID 44513896
3-[2-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]ethynyl]phenol (PubChem CID 44513896) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[2-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]ethynyl]phenol.
| Compound Name | 3-[2-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]ethynyl]phenol |
|---|---|
| PubChem CID | 44513896 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[2-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]ethynyl]phenol |
| SMILES | Oc1cccc(C#Cc2cccc(CN3CCN(c4ccccn4)CC3)c2)c1 |
| InChI | InChI=1S/C24H23N3O/c28-23-8-4-6-21(18-23)11-10-20-5-3-7-22(17-20)19-26-13-15-27(16-14-26)24-9-1-2-12-25-24/h1-9,12,17-18,28H,13-16,19H2 |
| InChIKey | QRQAGSHGJSIAHK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|