About 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride
6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride (PubChem CID 23321160) has the molecular formula C15H20ClN3
and a molecular weight of 277.80 g/mol. Its IUPAC name is 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride |
| PubChem CID | 23321160 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride |
| SMILES | Cc1cc2cnc(N3CCNCC3)cc2cc1C.Cl |
| InChI | InChI=1S/C15H19N3.ClH/c1-11-7-13-9-15(18-5-3-16-4-6-18)17-10-14(13)8-12(11)2;/h7-10,16H,3-6H2,1-2H3;1H |
| InChIKey | YWJBCELEMKHKGL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride?
The IUPAC name of 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride (CID 23321160) is 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride.
What is the SMILES notation for 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride?
The canonical SMILES for 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride is Cc1cc2cnc(N3CCNCC3)cc2cc1C.Cl.
What is the InChIKey of 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride?
The InChIKey is YWJBCELEMKHKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3.ClH/c1-11-7-13-9-15(18-5-3-16-4-6-18)17-10-14(13)8-12(11)2;/h7-10,16H,3-6H2,1-2H3;1H.
What are the key properties of 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride?
6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride has a molecular weight of 277.80 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-3-piperazin-1-ylisoquinoline;hydrochloride is sourced from PubChem (CID 23321160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).