C11H15N3O — CID 112710471
6-piperazin-1-yl-1,3-dihydrofuro[3,4-c]pyridine (PubChem CID 112710471) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-piperazin-1-yl-1,3-dihydrofuro[3,4-c]pyridine.
| Compound Name | 6-piperazin-1-yl-1,3-dihydrofuro[3,4-c]pyridine |
|---|---|
| PubChem CID | 112710471 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-piperazin-1-yl-1,3-dihydrofuro[3,4-c]pyridine |
| SMILES | c1nc(N2CCNCC2)cc2c1COC2 |
| InChI | InChI=1S/C11H15N3O/c1-3-14(4-2-12-1)11-5-9-7-15-8-10(9)6-13-11/h5-6,12H,1-4,7-8H2 |
| InChIKey | LANOREDYLSDAPI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |