C18H19N3O — CID 159120939
5-(6-piperazin-1-yl-3-pyridinyl)-1,3-dihydroinden-2-one (PubChem CID 159120939) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-(6-piperazin-1-yl-3-pyridinyl)-1,3-dihydroinden-2-one.
| Compound Name | 5-(6-piperazin-1-yl-3-pyridinyl)-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 159120939 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 5-(6-piperazin-1-yl-3-pyridinyl)-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2ccc(-c3ccc(N4CCNCC4)nc3)cc2C1 |
| InChI | InChI=1S/C18H19N3O/c22-17-10-14-2-1-13(9-16(14)11-17)15-3-4-18(20-12-15)21-7-5-19-6-8-21/h1-4,9,12,19H,5-8,10-11H2 |
| InChIKey | KFRMIELGIXISIA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |