C17H19N5O — CID 148878335
5-[(2-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-dihydroinden-2-one (PubChem CID 148878335) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-[(2-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-dihydroinden-2-one.
| Compound Name | 5-[(2-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 148878335 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 5-[(2-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2ccc(Nc3ccnc(N4CCNCC4)n3)cc2C1 |
| InChI | InChI=1S/C17H19N5O/c23-15-10-12-1-2-14(9-13(12)11-15)20-16-3-4-19-17(21-16)22-7-5-18-6-8-22/h1-4,9,18H,5-8,10-11H2,(H,19,20,21) |
| InChIKey | PCOCGPRQTPTNPI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |