C18H19N7 — CID 175927659
2-piperazin-1-yl-N-(4-pyridazin-3-ylphenyl)pyrimidin-4-amine (PubChem CID 175927659) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(4-pyridazin-3-ylphenyl)pyrimidin-4-amine.
| Compound Name | 2-piperazin-1-yl-N-(4-pyridazin-3-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 175927659 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-piperazin-1-yl-N-(4-pyridazin-3-ylphenyl)pyrimidin-4-amine |
| SMILES | c1cnnc(-c2ccc(Nc3ccnc(N4CCNCC4)n3)cc2)c1 |
| InChI | InChI=1S/C18H19N7/c1-2-16(24-21-8-1)14-3-5-15(6-4-14)22-17-7-9-20-18(23-17)25-12-10-19-11-13-25/h1-9,19H,10-13H2,(H,20,22,23) |
| InChIKey | ZKZJXTGOKDYYGJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |