C25H32N6O2S — CID 162659384
4-pentyl-N-[4-[(2-piperazin-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide (PubChem CID 162659384) has the molecular formula C25H32N6O2S and a molecular weight of 480.64 g/mol. Its IUPAC name is 4-pentyl-N-[4-[(2-piperazin-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-pentyl-N-[4-[(2-piperazin-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162659384 |
| Molecular Formula | C25H32N6O2S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-pentyl-N-[4-[(2-piperazin-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)Nc2ccc(Nc3ccnc(N4CCNCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C25H32N6O2S/c1-2-3-4-5-20-6-12-23(13-7-20)34(32,33)30-22-10-8-21(9-11-22)28-24-14-15-27-25(29-24)31-18-16-26-17-19-31/h6-15,26,30H,2-5,16-19H2,1H3,(H,27,28,29) |
| InChIKey | CDAUMHZDVCDAFS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|