C12H17N3O — CID 83837195
3-(piperazin-1-ylmethyl)-5,7-dihydrofuro[3,4-b]pyridine (PubChem CID 83837195) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)-5,7-dihydrofuro[3,4-b]pyridine.
| Compound Name | 3-(piperazin-1-ylmethyl)-5,7-dihydrofuro[3,4-b]pyridine |
|---|---|
| PubChem CID | 83837195 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)-5,7-dihydrofuro[3,4-b]pyridine |
| SMILES | c1nc2c(cc1CN1CCNCC1)COC2 |
| InChI | InChI=1S/C12H17N3O/c1-3-15(4-2-13-1)7-10-5-11-8-16-9-12(11)14-6-10/h5-6,13H,1-4,7-9H2 |
| InChIKey | UAXUDGXIKVELIX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |