About cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one
cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one (PubChem CID 177022352) has the molecular formula C16H23CsN4O
and a molecular weight of 420.29 g/mol. Its IUPAC name is cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one.
Molecular Properties
| Compound Name | cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one |
| PubChem CID | 177022352 |
| Molecular Formula | C16H23CsN4O |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCNCC3)cc2[nH]c1=O.[CH3-].[Cs+] |
| InChI | InChI=1S/C15H20N4O.CH3.Cs/c1-2-12-8-13-14(18-15(12)20)7-11(9-17-13)10-19-5-3-16-4-6-19;;/h7-9,16H,2-6,10H2,1H3,(H,18,20);1H3;/q;-1;+1 |
| InChIKey | BITSZVBRWGIRHZ-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one?
The IUPAC name of cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one (CID 177022352) is cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one.
What is the SMILES notation for cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one?
The canonical SMILES for cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one is CCc1cc2ncc(CN3CCNCC3)cc2[nH]c1=O.[CH3-].[Cs+].
What is the InChIKey of cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one?
The InChIKey is BITSZVBRWGIRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O.CH3.Cs/c1-2-12-8-13-14(18-15(12)20)7-11(9-17-13)10-19-5-3-16-4-6-19;;/h7-9,16H,2-6,10H2,1H3,(H,18,20);1H3;/q;-1;+1.
What are the key properties of cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one?
cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one has a molecular weight of 420.29 g/mol, XLogP of -1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one is sourced from PubChem (CID 177022352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).