C16H23CsN4O — CID 177022352
cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one (PubChem CID 177022352) has the molecular formula C16H23CsN4O and a molecular weight of 420.29 g/mol. Its IUPAC name is cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one.
| Compound Name | cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 177022352 |
| Molecular Formula | C16H23CsN4O |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | cesium;carbanide;3-ethyl-7-(piperazin-1-ylmethyl)-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCNCC3)cc2[nH]c1=O.[CH3-].[Cs+] |
| InChI | InChI=1S/C15H20N4O.CH3.Cs/c1-2-12-8-13-14(18-15(12)20)7-11(9-17-13)10-19-5-3-16-4-6-19;;/h7-9,16H,2-6,10H2,1H3,(H,18,20);1H3;/q;-1;+1 |
| InChIKey | BITSZVBRWGIRHZ-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|