C19H26N4OS — CID 177022419
3-ethyl-7-[[4-(2-methylpropanethioyl)piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one (PubChem CID 177022419) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-ethyl-7-[[4-(2-methylpropanethioyl)piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-ethyl-7-[[4-(2-methylpropanethioyl)piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 177022419 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-ethyl-7-[[4-(2-methylpropanethioyl)piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCN(C(=S)C(C)C)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C19H26N4OS/c1-4-15-10-16-17(21-18(15)24)9-14(11-20-16)12-22-5-7-23(8-6-22)19(25)13(2)3/h9-11,13H,4-8,12H2,1-3H3,(H,21,24) |
| InChIKey | LAMSWYZDVFEUHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|