C21H29N7O2 — CID 174200353
(2Z,4E)-2,5-diamino-5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N-methylpenta-2,4-dienamide (PubChem CID 174200353) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N-methylpenta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,5-diamino-5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 174200353 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (2Z,4E)-2,5-diamino-5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N-methylpenta-2,4-dienamide |
| SMILES | CCc1cc2ncc(CN3CCN(/C(N)=C/C=C(\N)C(=O)NC)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C21H29N7O2/c1-3-15-11-17-18(26-20(15)29)10-14(12-25-17)13-27-6-8-28(9-7-27)19(23)5-4-16(22)21(30)24-2/h4-5,10-12H,3,6-9,13,22-23H2,1-2H3,(H,24,30)(H,26,29)/b16-4-,19-5+ |
| InChIKey | FSYXLBYFEZJKEA-DWCXBNNYSA-N |
| XLogP | -0.01 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|