C22H29Cl2N7O2 — CID 178131901
5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N'-methylpyridine-2-carbohydrazide;dihydrochloride (PubChem CID 178131901) has the molecular formula C22H29Cl2N7O2 and a molecular weight of 494.43 g/mol. Its IUPAC name is 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N'-methylpyridine-2-carbohydrazide;dihydrochloride.
| Compound Name | 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N'-methylpyridine-2-carbohydrazide;dihydrochloride |
|---|---|
| PubChem CID | 178131901 |
| Molecular Formula | C22H29Cl2N7O2 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N'-methylpyridine-2-carbohydrazide;dihydrochloride |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(C(=O)NNC)nc4)CC3)cc2[nH]c1=O.Cl.Cl |
| InChI | InChI=1S/C22H27N7O2.2ClH/c1-3-16-11-19-20(26-21(16)30)10-15(12-24-19)14-28-6-8-29(9-7-28)17-4-5-18(25-13-17)22(31)27-23-2;;/h4-5,10-13,23H,3,6-9,14H2,1-2H3,(H,26,30)(H,27,31);2*1H |
| InChIKey | OIXCPECDKPKLPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|