C22H25BN6O3 — CID 166088951
CID 166088951 (PubChem CID 166088951) has the molecular formula C22H25BN6O3 and a molecular weight of 432.29 g/mol.
| Compound Name | CID 166088951 |
|---|---|
| PubChem CID | 166088951 |
| Molecular Formula | C22H25BN6O3 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1cnc2cc(CC)c(=O)[nH]c2c1)N1CCN(c2ccc(C(=O)NC)nc2)CC1 |
| InChI | InChI=1S/C22H25BN6O3/c1-3-14-10-18-19(27-20(14)30)11-15(12-25-18)22(23,32)29-8-6-28(7-9-29)16-4-5-17(26-13-16)21(31)24-2/h4-5,10-13,32H,3,6-9H2,1-2H3,(H,24,31)(H,27,30) |
| InChIKey | UDRHYTPMMGIUSZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|