C23H32N6O2 — CID 178063334
(2Z,4Z,6E)-2,5-diamino-6-[1-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]pyrrolidin-3-ylidene]hexa-2,4-dienal;N-methylmethanamine (PubChem CID 178063334) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is (2Z,4Z,6E)-2,5-diamino-6-[1-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]pyrrolidin-3-ylidene]hexa-2,4-dienal;N-methylmethanamine.
| Compound Name | (2Z,4Z,6E)-2,5-diamino-6-[1-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]pyrrolidin-3-ylidene]hexa-2,4-dienal;N-methylmethanamine |
|---|---|
| PubChem CID | 178063334 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (2Z,4Z,6E)-2,5-diamino-6-[1-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]pyrrolidin-3-ylidene]hexa-2,4-dienal;N-methylmethanamine |
| SMILES | CCc1cc2ncc(CN3CC/C(=C\C(N)=C\C=C(/N)C=O)C3)cc2[nH]c1=O.CNC |
| InChI | InChI=1S/C21H25N5O2.C2H7N/c1-2-16-9-19-20(25-21(16)28)8-15(10-24-19)12-26-6-5-14(11-26)7-17(22)3-4-18(23)13-27;1-3-2/h3-4,7-10,13H,2,5-6,11-12,22-23H2,1H3,(H,25,28);3H,1-2H3/b14-7+,17-3-,18-4-; |
| InChIKey | IMFJGNHGPLGNKO-SKJSRJOUSA-N |
| XLogP | 1.34 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|