C22H24ClFN6O2 — CID 175493905
3-amino-2-chloro-4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluorobenzamide (PubChem CID 175493905) has the molecular formula C22H24ClFN6O2 and a molecular weight of 458.93 g/mol. Its IUPAC name is 3-amino-2-chloro-4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluorobenzamide.
| Compound Name | 3-amino-2-chloro-4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 175493905 |
| Molecular Formula | C22H24ClFN6O2 |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-amino-2-chloro-4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluorobenzamide |
| SMILES | CCc1cc2ncc(CN3CCN(c4cc(F)c(C(N)=O)c(Cl)c4N)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H24ClFN6O2/c1-2-13-8-15-16(28-22(13)32)7-12(10-27-15)11-29-3-5-30(6-4-29)17-9-14(24)18(21(26)31)19(23)20(17)25/h7-10H,2-6,11,25H2,1H3,(H2,26,31)(H,28,32) |
| InChIKey | OHAGSCPDPQYPJW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|