C25H30FN5O3 — CID 166082534
4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-3-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 166082534) has the molecular formula C25H30FN5O3 and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-3-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-3-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 166082534 |
| Molecular Formula | C25H30FN5O3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 4-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-3-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(C(=O)NCCOC)cc4F)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C25H30FN5O3/c1-3-18-14-21-22(29-25(18)33)12-17(15-28-21)16-30-7-9-31(10-8-30)23-5-4-19(13-20(23)26)24(32)27-6-11-34-2/h4-5,12-15H,3,6-11,16H2,1-2H3,(H,27,32)(H,29,33) |
| InChIKey | IUDPUWATCZHQIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|